C20H34F3IN4O2 — CID 111969126
1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide (PubChem CID 111969126) has the molecular formula C20H34F3IN4O2 and a molecular weight of 546.42 g/mol. Its IUPAC name is 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111969126 |
| Molecular Formula | C20H34F3IN4O2 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCC1CCN(CC(F)(F)F)CC1.I |
| InChI | InChI=1S/C20H33F3N4O2.HI/c1-2-24-19(25-9-4-13-28-15-18-5-3-14-29-18)26-10-6-17-7-11-27(12-8-17)16-20(21,22)23;/h3,5,14,17H,2,4,6-13,15-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | CJAOLGITVVAFAC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|