C18H29F3N4O2 — CID 111398559
1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 111398559) has the molecular formula C18H29F3N4O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111398559 |
| Molecular Formula | C18H29F3N4O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-ethyl-3-[3-(furan-2-ylmethoxy)propyl]-2-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1CCN(CC(F)(F)F)C1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C18H29F3N4O2/c1-2-22-17(23-7-4-9-26-13-16-5-3-10-27-16)24-11-15-6-8-25(12-15)14-18(19,20)21/h3,5,10,15H,2,4,6-9,11-14H2,1H3,(H2,22,23,24) |
| InChIKey | FOJMMZJVMIHMHV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|