C21H40IN5O2 — CID 111399050
1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111399050) has the molecular formula C21H40IN5O2 and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111399050 |
| Molecular Formula | C21H40IN5O2 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 1-ethyl-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCCCN1CCN(CC)CC1.I |
| InChI | InChI=1S/C21H39N5O2.HI/c1-3-22-21(24-11-8-17-27-19-20-9-7-18-28-20)23-10-5-6-12-26-15-13-25(4-2)14-16-26;/h7,9,18H,3-6,8,10-17,19H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | QCRNQPKTLYVHJE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|