C20H31IN4O4S — CID 111399164
1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111399164) has the molecular formula C20H31IN4O4S and a molecular weight of 550.46 g/mol. Its IUPAC name is 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111399164 |
| Molecular Formula | C20H31IN4O4S |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 1-ethyl-2-[3-(furan-2-ylmethoxy)propyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCNS(=O)(=O)c1ccc(C)cc1.I |
| InChI | InChI=1S/C20H30N4O4S.HI/c1-3-21-20(22-11-5-14-27-16-18-6-4-15-28-18)23-12-13-24-29(25,26)19-9-7-17(2)8-10-19;/h4,6-10,15,24H,3,5,11-14,16H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | HXIOJAOJFKLKHW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|