C15H23ClIN7O2S — CID 111706758
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111706758) has the molecular formula C15H23ClIN7O2S and a molecular weight of 527.82 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111706758 |
| Molecular Formula | C15H23ClIN7O2S |
| Molecular Weight | 527.82 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCCNS(=O)(=O)c1cccc(Cl)c1.I |
| InChI | InChI=1S/C15H22ClN7O2S.HI/c1-3-17-15(19-10-14-20-11-21-23(14)2)18-7-8-22-26(24,25)13-6-4-5-12(16)9-13;/h4-6,9,11,22H,3,7-8,10H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | ILJZTQGIIUOSHM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.82 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|