C16H22N6S — CID 24885203
(2E)-2-[2-(3-aminopropylamino)pyrimidin-4-yl]-2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)acetonitrile (PubChem CID 24885203) has the molecular formula C16H22N6S and a molecular weight of 330.46 g/mol. Its IUPAC name is (2E)-2-[2-(3-aminopropylamino)pyrimidin-4-yl]-2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)acetonitrile.
| Compound Name | (2E)-2-[2-(3-aminopropylamino)pyrimidin-4-yl]-2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 24885203 |
| Molecular Formula | C16H22N6S |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2E)-2-[2-(3-aminopropylamino)pyrimidin-4-yl]-2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)acetonitrile |
| SMILES | CC(C)(C)C1=CS/C(=C(/C#N)c2ccnc(NCCCN)n2)N1 |
| InChI | InChI=1S/C16H22N6S/c1-16(2,3)13-10-23-14(22-13)11(9-18)12-5-8-20-15(21-12)19-7-4-6-17/h5,8,10,22H,4,6-7,17H2,1-3H3,(H,19,20,21)/b14-11- |
| InChIKey | SVKFLQIIUMIACQ-KAMYIIQDSA-N |
| XLogP | 2.65 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|