C23H20N6S — CID 69313795
(2Z)-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 69313795) has the molecular formula C23H20N6S and a molecular weight of 412.52 g/mol. Its IUPAC name is (2Z)-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69313795 |
| Molecular Formula | C23H20N6S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (2Z)-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(2-pyridin-3-ylethylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | Cc1ccc(C2=CS/C(=C(\C#N)c3ccnc(NCCc4cccnc4)n3)N2)cc1 |
| InChI | InChI=1S/C23H20N6S/c1-16-4-6-18(7-5-16)21-15-30-22(28-21)19(13-24)20-9-12-27-23(29-20)26-11-8-17-3-2-10-25-14-17/h2-7,9-10,12,14-15,28H,8,11H2,1H3,(H,26,27,29)/b22-19+ |
| InChIKey | HOEFKMATBMAAQV-ZBJSNUHESA-N |
| XLogP | 4.36 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|