C18H17N5O — CID 69456155
2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-(cyclopentylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 69456155) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-(cyclopentylamino)pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-(cyclopentylamino)pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69456155 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-(cyclopentylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(=C1Nc2ccccc2O1)c1ccnc(NC2CCCC2)n1 |
| InChI | InChI=1S/C18H17N5O/c19-11-13(17-22-15-7-3-4-8-16(15)24-17)14-9-10-20-18(23-14)21-12-5-1-2-6-12/h3-4,7-10,12,22H,1-2,5-6H2,(H,20,21,23) |
| InChIKey | QEERLOJGCZKDDI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|