C18H16N8O — CID 58940899
(2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 58940899) has the molecular formula C18H16N8O and a molecular weight of 360.38 g/mol. Its IUPAC name is (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 58940899 |
| Molecular Formula | C18H16N8O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[3-(1,2,4-triazol-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1\Nc2ccccc2O1)c1ccnc(NCCCn2cncn2)n1 |
| InChI | InChI=1S/C18H16N8O/c19-10-13(17-24-15-4-1-2-5-16(15)27-17)14-6-8-22-18(25-14)21-7-3-9-26-12-20-11-23-26/h1-2,4-6,8,11-12,24H,3,7,9H2,(H,21,22,25)/b17-13- |
| InChIKey | YZIDARNOQVREEY-LGMDPLHJSA-N |
| XLogP | 2.27 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|