C23H19N5O4 — CID 69456310
2-[4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]phenoxy]propanoic acid (PubChem CID 69456310) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-[4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 69456310 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-[4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(CNc2nccc(C(C#N)=C3Nc4ccccc4O3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C23H19N5O4/c1-14(22(29)30)31-16-8-6-15(7-9-16)13-26-23-25-11-10-18(28-23)17(12-24)21-27-19-4-2-3-5-20(19)32-21/h2-11,14,27H,13H2,1H3,(H,29,30)(H,25,26,28) |
| InChIKey | AGNTUXJEAUANFQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|