C22H17N5O3 — CID 69456308
methyl 4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]benzoate (PubChem CID 69456308) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is methyl 4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 69456308 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | methyl 4-[[[4-[3H-1,3-benzoxazol-2-ylidene(cyano)methyl]pyrimidin-2-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2nccc(C(C#N)=C3Nc4ccccc4O3)n2)cc1 |
| InChI | InChI=1S/C22H17N5O3/c1-29-21(28)15-8-6-14(7-9-15)13-25-22-24-11-10-17(27-22)16(12-23)20-26-18-4-2-3-5-19(18)30-20/h2-11,26H,13H2,1H3,(H,24,25,27) |
| InChIKey | VJHGZZDRQBTTOT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|