C17H15NO4 — CID 22478824
methyl 4-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzoate (PubChem CID 22478824) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 4-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzoate.
| Compound Name | methyl 4-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 22478824 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 4-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CC2Oc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-21-17(20)12-8-6-11(7-9-12)10-15-16(19)18-13-4-2-3-5-14(13)22-15/h2-9,15H,10H2,1H3,(H,18,19) |
| InChIKey | FJWVIQKPWKBNHL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |