C24H29N7O3 — CID 58940893
(2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-[4-(2-methoxyethyl)piperazin-1-yl]-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile (PubChem CID 58940893) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-[4-(2-methoxyethyl)piperazin-1-yl]-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-[4-(2-methoxyethyl)piperazin-1-yl]-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 58940893 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-[4-(2-methoxyethyl)piperazin-1-yl]-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile |
| SMILES | COCCN1CCN(C(=O)CCCNc2nccc(/C(C#N)=C3/Nc4ccccc4O3)n2)CC1 |
| InChI | InChI=1S/C24H29N7O3/c1-33-16-15-30-11-13-31(14-12-30)22(32)7-4-9-26-24-27-10-8-19(29-24)18(17-25)23-28-20-5-2-3-6-21(20)34-23/h2-3,5-6,8,10,28H,4,7,9,11-16H2,1H3,(H,26,27,29)/b23-18- |
| InChIKey | BETZEXCYJABYNE-NKFKGCMQSA-N |
| XLogP | 2.16 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|