C24H29N7O2 — CID 69456670
(2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-(4-propan-2-ylpiperazin-1-yl)butyl]amino]pyrimidin-4-yl]acetonitrile (PubChem CID 69456670) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-(4-propan-2-ylpiperazin-1-yl)butyl]amino]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-(4-propan-2-ylpiperazin-1-yl)butyl]amino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69456670 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (2E)-2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-(4-propan-2-ylpiperazin-1-yl)butyl]amino]pyrimidin-4-yl]acetonitrile |
| SMILES | CC(C)N1CCN(C(=O)CCCNc2nccc(/C(C#N)=C3/Nc4ccccc4O3)n2)CC1 |
| InChI | InChI=1S/C24H29N7O2/c1-17(2)30-12-14-31(15-13-30)22(32)8-5-10-26-24-27-11-9-19(29-24)18(16-25)23-28-20-6-3-4-7-21(20)33-23/h3-4,6-7,9,11,17,28H,5,8,10,12-15H2,1-2H3,(H,26,27,29)/b23-18- |
| InChIKey | IOPUSGXAMGMPLC-NKFKGCMQSA-N |
| XLogP | 2.92 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|