C23H27N7O2 — CID 91220231
2-(1,3-benzoxazol-2-yl)-2-[2-[[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile (PubChem CID 91220231) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-2-[2-[[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-2-[2-[[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 91220231 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-2-[2-[[4-(4-ethylpiperazin-1-yl)-4-oxobutyl]amino]pyrimidin-4-yl]acetonitrile |
| SMILES | CCN1CCN(C(=O)CCCNc2nccc(C(C#N)c3nc4ccccc4o3)n2)CC1 |
| InChI | InChI=1S/C23H27N7O2/c1-2-29-12-14-30(15-13-29)21(31)8-5-10-25-23-26-11-9-18(28-23)17(16-24)22-27-19-6-3-4-7-20(19)32-22/h3-4,6-7,9,11,17H,2,5,8,10,12-15H2,1H3,(H,25,26,28) |
| InChIKey | PTDCPFXJBGAQHL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|