C19H19N5O3 — CID 91038568
methyl 4-[[4-[1,3-benzoxazol-2-yl(cyano)methyl]-5-methylpyrimidin-2-yl]amino]butanoate (PubChem CID 91038568) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 4-[[4-[1,3-benzoxazol-2-yl(cyano)methyl]-5-methylpyrimidin-2-yl]amino]butanoate.
| Compound Name | methyl 4-[[4-[1,3-benzoxazol-2-yl(cyano)methyl]-5-methylpyrimidin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 91038568 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | methyl 4-[[4-[1,3-benzoxazol-2-yl(cyano)methyl]-5-methylpyrimidin-2-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1ncc(C)c(C(C#N)c2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C19H19N5O3/c1-12-11-22-19(21-9-5-8-16(25)26-2)24-17(12)13(10-20)18-23-14-6-3-4-7-15(14)27-18/h3-4,6-7,11,13H,5,8-9H2,1-2H3,(H,21,22,24) |
| InChIKey | WDXGRMKNQYSTLV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|