C16H20N2O4 — CID 26317738
methyl 4-[(2-propan-2-yl-1,3-benzoxazole-5-carbonyl)amino]butanoate (PubChem CID 26317738) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl 4-[(2-propan-2-yl-1,3-benzoxazole-5-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(2-propan-2-yl-1,3-benzoxazole-5-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 26317738 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl 4-[(2-propan-2-yl-1,3-benzoxazole-5-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc2oc(C(C)C)nc2c1 |
| InChI | InChI=1S/C16H20N2O4/c1-10(2)16-18-12-9-11(6-7-13(12)22-16)15(20)17-8-4-5-14(19)21-3/h6-7,9-10H,4-5,8H2,1-3H3,(H,17,20) |
| InChIKey | UKORXPGWDMOGOV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|