C22H24N6O2 — CID 90851687
2-(1,3-benzoxazol-2-yl)-2-[2-[(4-oxo-4-piperidin-1-ylbutyl)amino]pyrimidin-4-yl]acetonitrile (PubChem CID 90851687) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-2-[2-[(4-oxo-4-piperidin-1-ylbutyl)amino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-2-[2-[(4-oxo-4-piperidin-1-ylbutyl)amino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 90851687 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-2-[2-[(4-oxo-4-piperidin-1-ylbutyl)amino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(c1ccnc(NCCCC(=O)N2CCCCC2)n1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H24N6O2/c23-15-16(21-26-18-7-2-3-8-19(18)30-21)17-10-12-25-22(27-17)24-11-6-9-20(29)28-13-4-1-5-14-28/h2-3,7-8,10,12,16H,1,4-6,9,11,13-14H2,(H,24,25,27) |
| InChIKey | HEOSNOOMHMCMJZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|