C27H32N8O3 — CID 69455199
2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]amino]pyrimidin-4-yl]acetonitrile (PubChem CID 69455199) has the molecular formula C27H32N8O3 and a molecular weight of 516.61 g/mol. Its IUPAC name is 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]amino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]amino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69455199 |
| Molecular Formula | C27H32N8O3 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-(3H-1,3-benzoxazol-2-ylidene)-2-[2-[[4-oxo-4-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]butyl]amino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(=C1Nc2ccccc2O1)c1ccnc(NCCCC(=O)N2CCN(CC(=O)N3CCCC3)CC2)n1 |
| InChI | InChI=1S/C27H32N8O3/c28-18-20(26-31-22-6-1-2-7-23(22)38-26)21-9-11-30-27(32-21)29-10-5-8-24(36)35-16-14-33(15-17-35)19-25(37)34-12-3-4-13-34/h1-2,6-7,9,11,31H,3-5,8,10,12-17,19H2,(H,29,30,32) |
| InChIKey | NFBROKKJUMXSGE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|