C15H25N5O2 — CID 56802485
1-[4-(2-hydroxypropyl)piperazin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 56802485) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[4-(2-hydroxypropyl)piperazin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[4-(2-hydroxypropyl)piperazin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 56802485 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-[4-(2-hydroxypropyl)piperazin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | CC(O)CN1CCN(C(=O)CCCNc2ncccn2)CC1 |
| InChI | InChI=1S/C15H25N5O2/c1-13(21)12-19-8-10-20(11-9-19)14(22)4-2-5-16-15-17-6-3-7-18-15/h3,6-7,13,21H,2,4-5,8-12H2,1H3,(H,16,17,18) |
| InChIKey | MJHAPLMWHQZDIN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|