C19H31N5O3 — CID 124953343
1-[(4R)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 124953343) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[(4R)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[(4R)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 124953343 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 1-[(4R)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | O=C(CCCNc1ncccn1)N1CCC[C@](O)(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C19H31N5O3/c25-17(4-1-7-20-18-21-8-3-9-22-18)24-10-2-5-19(26,6-11-24)16-23-12-14-27-15-13-23/h3,8-9,26H,1-2,4-7,10-16H2,(H,20,21,22)/t19-/m1/s1 |
| InChIKey | DUSBAAYIZIUQGW-LJQANCHMSA-N |
| XLogP | 0.74 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|