C15H27N3O4 — CID 124971416
4-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-oxobutanamide (PubChem CID 124971416) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-oxobutanamide.
| Compound Name | 4-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 124971416 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-[(4S)-4-hydroxy-4-(morpholin-4-ylmethyl)azepan-1-yl]-4-oxobutanamide |
| SMILES | NC(=O)CCC(=O)N1CCC[C@@](O)(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H27N3O4/c16-13(19)2-3-14(20)18-6-1-4-15(21,5-7-18)12-17-8-10-22-11-9-17/h21H,1-12H2,(H2,16,19)/t15-/m0/s1 |
| InChIKey | JWFMSHFWTKQNRF-HNNXBMFYSA-N |
| XLogP | -0.67 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |