C13H10N2O3S — CID 41076181
S-[(3R)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl] ethanethioate (PubChem CID 41076181) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is S-[(3R)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl] ethanethioate.
| Compound Name | S-[(3R)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 41076181 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | S-[(3R)-3-(1,3-benzoxazol-2-yl)-3-cyano-2-oxopropyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)[C@H](C#N)c1nc2ccccc2o1 |
| InChI | InChI=1S/C13H10N2O3S/c1-8(16)19-7-11(17)9(6-14)13-15-10-4-2-3-5-12(10)18-13/h2-5,9H,7H2,1H3/t9-/m0/s1 |
| InChIKey | WDYHZUGNZVKLPM-VIFPVBQESA-N |
| XLogP | 2.28 |
| TPSA | 83.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|