C14H10FN3O3S — CID 136828893
S-[(3S)-3-cyano-3-(6-fluoro-4-oxo-3H-quinazolin-2-yl)-2-oxopropyl] ethanethioate (PubChem CID 136828893) has the molecular formula C14H10FN3O3S and a molecular weight of 319.32 g/mol. Its IUPAC name is S-[(3S)-3-cyano-3-(6-fluoro-4-oxo-3H-quinazolin-2-yl)-2-oxopropyl] ethanethioate.
| Compound Name | S-[(3S)-3-cyano-3-(6-fluoro-4-oxo-3H-quinazolin-2-yl)-2-oxopropyl] ethanethioate |
|---|---|
| PubChem CID | 136828893 |
| Molecular Formula | C14H10FN3O3S |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | S-[(3S)-3-cyano-3-(6-fluoro-4-oxo-3H-quinazolin-2-yl)-2-oxopropyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)[C@@H](C#N)c1nc2ccc(F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H10FN3O3S/c1-7(19)22-6-12(20)10(5-16)13-17-11-3-2-8(15)4-9(11)14(21)18-13/h2-4,10H,6H2,1H3,(H,17,18,21)/t10-/m1/s1 |
| InChIKey | RJBMFHLAKHXHEF-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|