C20H12Cl2N4O2 — CID 137061638
2-[6-(3-aminoprop-1-ynyl)-4-oxo-3H-quinazolin-2-yl]-3-(2,4-dichlorophenyl)-3-oxopropanenitrile (PubChem CID 137061638) has the molecular formula C20H12Cl2N4O2 and a molecular weight of 411.25 g/mol. Its IUPAC name is 2-[6-(3-aminoprop-1-ynyl)-4-oxo-3H-quinazolin-2-yl]-3-(2,4-dichlorophenyl)-3-oxopropanenitrile.
| Compound Name | 2-[6-(3-aminoprop-1-ynyl)-4-oxo-3H-quinazolin-2-yl]-3-(2,4-dichlorophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 137061638 |
| Molecular Formula | C20H12Cl2N4O2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-[6-(3-aminoprop-1-ynyl)-4-oxo-3H-quinazolin-2-yl]-3-(2,4-dichlorophenyl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1ccc(Cl)cc1Cl)c1nc2ccc(C#CCN)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H12Cl2N4O2/c21-12-4-5-13(16(22)9-12)18(27)15(10-24)19-25-17-6-3-11(2-1-7-23)8-14(17)20(28)26-19/h3-6,8-9,15H,7,23H2,(H,25,26,28) |
| InChIKey | XPHJRMJGCLQGBC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|