C27H25N7O3 — CID 57019058
1-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 57019058) has the molecular formula C27H25N7O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | 1-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 57019058 |
| Molecular Formula | C27H25N7O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-[4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2ccc(-c3ccnc(NCCNc4ccc([N+](=O)[O-])cn4)n3)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C27H25N7O3/c28-25(35)27(16-22(27)18-4-2-1-3-5-18)20-8-6-19(7-9-20)23-12-13-30-26(33-23)31-15-14-29-24-11-10-21(17-32-24)34(36)37/h1-13,17,22H,14-16H2,(H2,28,35)(H,29,32)(H,30,31,33) |
| InChIKey | WJARWEMSKVQYBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|