C25H24N8O3 — CID 22143025
N-[4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylacetamide (PubChem CID 22143025) has the molecular formula C25H24N8O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylacetamide.
| Compound Name | N-[4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 22143025 |
| Molecular Formula | C25H24N8O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]phenyl]-2-phenylacetamide |
| SMILES | Nc1nc(NCCNc2nccc(-c3ccc(NC(=O)Cc4ccccc4)cc3)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H24N8O3/c26-24-21(33(35)36)10-11-22(32-24)27-14-15-29-25-28-13-12-20(31-25)18-6-8-19(9-7-18)30-23(34)16-17-4-2-1-3-5-17/h1-13H,14-16H2,(H,30,34)(H3,26,27,32)(H,28,29,31) |
| InChIKey | DUSKZCCALLFOSM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|