C12H11N5O4 — CID 79826302
3-nitro-6-N-[(3-nitrophenyl)methyl]pyridine-2,6-diamine (PubChem CID 79826302) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-nitro-6-N-[(3-nitrophenyl)methyl]pyridine-2,6-diamine.
| Compound Name | 3-nitro-6-N-[(3-nitrophenyl)methyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 79826302 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-nitro-6-N-[(3-nitrophenyl)methyl]pyridine-2,6-diamine |
| SMILES | Nc1nc(NCc2cccc([N+](=O)[O-])c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N5O4/c13-12-10(17(20)21)4-5-11(15-12)14-7-8-2-1-3-9(6-8)16(18)19/h1-6H,7H2,(H3,13,14,15) |
| InChIKey | VSEWAFJODSRAJW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|