C19H19N7O3 — CID 22142855
4-[2-[3-[(5-nitro-2-pyridinyl)amino]propylamino]pyrimidin-4-yl]benzamide (PubChem CID 22142855) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 4-[2-[3-[(5-nitro-2-pyridinyl)amino]propylamino]pyrimidin-4-yl]benzamide.
| Compound Name | 4-[2-[3-[(5-nitro-2-pyridinyl)amino]propylamino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22142855 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-[2-[3-[(5-nitro-2-pyridinyl)amino]propylamino]pyrimidin-4-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccnc(NCCCNc3ccc([N+](=O)[O-])cn3)n2)cc1 |
| InChI | InChI=1S/C19H19N7O3/c20-18(27)14-4-2-13(3-5-14)16-8-11-23-19(25-16)22-10-1-9-21-17-7-6-15(12-24-17)26(28)29/h2-8,11-12H,1,9-10H2,(H2,20,27)(H,21,24)(H,22,23,25) |
| InChIKey | KHDCNLWYERKKRW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|