C25H21F2N7O3 — CID 22142708
N-[(3,4-difluorophenyl)methyl]-4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzamide (PubChem CID 22142708) has the molecular formula C25H21F2N7O3 and a molecular weight of 505.49 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22142708 |
| Molecular Formula | C25H21F2N7O3 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidin-4-yl]benzamide |
| SMILES | O=C(NCc1ccc(F)c(F)c1)c1ccc(-c2ccnc(NCCNc3ccc([N+](=O)[O-])cn3)n2)cc1 |
| InChI | InChI=1S/C25H21F2N7O3/c26-20-7-1-16(13-21(20)27)14-32-24(35)18-4-2-17(3-5-18)22-9-10-29-25(33-22)30-12-11-28-23-8-6-19(15-31-23)34(36)37/h1-10,13,15H,11-12,14H2,(H,28,31)(H,32,35)(H,29,30,33) |
| InChIKey | IJBFIAFQIFLRAS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|