C24H21FN6O2 — CID 173278701
N'-[(3-fluorophenyl)methyl]-N-(5-nitro-2-pyridinyl)-N'-(4-phenylpyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 173278701) has the molecular formula C24H21FN6O2 and a molecular weight of 444.47 g/mol. Its IUPAC name is N'-[(3-fluorophenyl)methyl]-N-(5-nitro-2-pyridinyl)-N'-(4-phenylpyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-[(3-fluorophenyl)methyl]-N-(5-nitro-2-pyridinyl)-N'-(4-phenylpyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 173278701 |
| Molecular Formula | C24H21FN6O2 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N'-[(3-fluorophenyl)methyl]-N-(5-nitro-2-pyridinyl)-N'-(4-phenylpyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCN(Cc2cccc(F)c2)c2nccc(-c3ccccc3)n2)nc1 |
| InChI | InChI=1S/C24H21FN6O2/c25-20-8-4-5-18(15-20)17-30(14-13-26-23-10-9-21(16-28-23)31(32)33)24-27-12-11-22(29-24)19-6-2-1-3-7-19/h1-12,15-16H,13-14,17H2,(H,26,28) |
| InChIKey | ANYDHINAKAOAQP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|