C27H24N8O7 — CID 22142370
ethyl 4-(4-carbamoylphenyl)-6-(4-nitrophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 22142370) has the molecular formula C27H24N8O7 and a molecular weight of 572.54 g/mol. Its IUPAC name is ethyl 4-(4-carbamoylphenyl)-6-(4-nitrophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-carbamoylphenyl)-6-(4-nitrophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142370 |
| Molecular Formula | C27H24N8O7 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | ethyl 4-(4-carbamoylphenyl)-6-(4-nitrophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(N)=O)cc2)nc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H24N8O7/c1-2-42-26(37)22-23(16-3-5-18(6-4-16)25(28)36)32-27(33-24(22)17-7-9-19(10-8-17)34(38)39)30-14-13-29-21-12-11-20(15-31-21)35(40)41/h3-12,15H,2,13-14H2,1H3,(H2,28,36)(H,29,31)(H,30,32,33) |
| InChIKey | DEYVDDNNBRGDHZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 218.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|