C24H29N7O4 — CID 22142471
ethyl 4-[4-(diethylamino)phenyl]-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 22142471) has the molecular formula C24H29N7O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is ethyl 4-[4-(diethylamino)phenyl]-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-(diethylamino)phenyl]-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142471 |
| Molecular Formula | C24H29N7O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | ethyl 4-[4-(diethylamino)phenyl]-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCNc2ccc([N+](=O)[O-])cn2)nc1-c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C24H29N7O4/c1-4-30(5-2)18-9-7-17(8-10-18)22-20(23(32)35-6-3)16-28-24(29-22)26-14-13-25-21-12-11-19(15-27-21)31(33)34/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,25,27)(H,26,28,29) |
| InChIKey | NYQLTGBYFBLCRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|