C20H17N7O4 — CID 172789996
4-(4-cyanophenyl)-2-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid (PubChem CID 172789996) has the molecular formula C20H17N7O4 and a molecular weight of 419.40 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-2-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-(4-cyanophenyl)-2-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 172789996 |
| Molecular Formula | C20H17N7O4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 4-(4-cyanophenyl)-2-[2-[(4-methyl-5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid |
| SMILES | Cc1cc(NCCNc2ncc(C(=O)O)c(-c3ccc(C#N)cc3)n2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17N7O4/c1-12-8-17(24-11-16(12)27(30)31)22-6-7-23-20-25-10-15(19(28)29)18(26-20)14-4-2-13(9-21)3-5-14/h2-5,8,10-11H,6-7H2,1H3,(H,22,24)(H,28,29)(H,23,25,26) |
| InChIKey | PKWKSSGFSLWLAJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 166.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|