C26H28N8O6 — CID 22142686
(2-hydroxy-3-morpholin-4-ylpropyl) 4-(4-cyanophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate (PubChem CID 22142686) has the molecular formula C26H28N8O6 and a molecular weight of 548.56 g/mol. Its IUPAC name is (2-hydroxy-3-morpholin-4-ylpropyl) 4-(4-cyanophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | (2-hydroxy-3-morpholin-4-ylpropyl) 4-(4-cyanophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 22142686 |
| Molecular Formula | C26H28N8O6 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (2-hydroxy-3-morpholin-4-ylpropyl) 4-(4-cyanophenyl)-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylate |
| SMILES | N#Cc1ccc(-c2nc(NCCNc3ccc([N+](=O)[O-])cn3)ncc2C(=O)OCC(O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H28N8O6/c27-13-18-1-3-19(4-2-18)24-22(25(36)40-17-21(35)16-33-9-11-39-12-10-33)15-31-26(32-24)29-8-7-28-23-6-5-20(14-30-23)34(37)38/h1-6,14-15,21,35H,7-12,16-17H2,(H,28,30)(H,29,31,32) |
| InChIKey | LZCKAHUPFXAXIX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 188.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|