C21H18N10O2 — CID 22142929
4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-5-(1H-imidazol-5-yl)pyrimidin-4-yl]benzonitrile (PubChem CID 22142929) has the molecular formula C21H18N10O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-5-(1H-imidazol-5-yl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-5-(1H-imidazol-5-yl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 22142929 |
| Molecular Formula | C21H18N10O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-5-(1H-imidazol-5-yl)pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(NCCNc3ccc([N+](=O)[O-])c(N)n3)ncc2-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C21H18N10O2/c22-9-13-1-3-14(4-2-13)19-15(16-11-24-12-28-16)10-27-21(30-19)26-8-7-25-18-6-5-17(31(32)33)20(23)29-18/h1-6,10-12H,7-8H2,(H,24,28)(H3,23,25,29)(H,26,27,30) |
| InChIKey | XWNWAKVUZJOENS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 184.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|