C22H18N8O4S — CID 54209945
N-[2-[[4-(4-cyanophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 54209945) has the molecular formula C22H18N8O4S and a molecular weight of 490.51 g/mol. Its IUPAC name is N-[2-[[4-(4-cyanophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[4-(4-cyanophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 54209945 |
| Molecular Formula | C22H18N8O4S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[2-[[4-(4-cyanophenyl)-5-(1H-imidazol-5-yl)pyrimidin-2-yl]amino]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | N#Cc1ccc(-c2nc(NCCNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)ncc2-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C22H18N8O4S/c23-11-15-1-3-16(4-2-15)21-19(20-13-24-14-27-20)12-26-22(29-21)25-9-10-28-35(33,34)18-7-5-17(6-8-18)30(31)32/h1-8,12-14,28H,9-10H2,(H,24,27)(H,25,26,29) |
| InChIKey | PVGFFDMAYBQCCU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 179.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|