C21H18N8O3 — CID 70020885
4-(4-cyanophenyl)-N,N-dimethyl-2-[2-[(5-nitro-2-pyridinyl)imino]ethylamino]pyrimidine-5-carboxamide (PubChem CID 70020885) has the molecular formula C21H18N8O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N,N-dimethyl-2-[2-[(5-nitro-2-pyridinyl)imino]ethylamino]pyrimidine-5-carboxamide.
| Compound Name | 4-(4-cyanophenyl)-N,N-dimethyl-2-[2-[(5-nitro-2-pyridinyl)imino]ethylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70020885 |
| Molecular Formula | C21H18N8O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-(4-cyanophenyl)-N,N-dimethyl-2-[2-[(5-nitro-2-pyridinyl)imino]ethylamino]pyrimidine-5-carboxamide |
| SMILES | CN(C)C(=O)c1cnc(NC/C=N/c2ccc([N+](=O)[O-])cn2)nc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H18N8O3/c1-28(2)20(30)17-13-26-21(27-19(17)15-5-3-14(11-22)4-6-15)24-10-9-23-18-8-7-16(12-25-18)29(31)32/h3-9,12-13H,10H2,1-2H3,(H,24,26,27)/b23-9+ |
| InChIKey | IBFZEFJJBNEDGU-NUGSKGIGSA-N |
| XLogP | 2.83 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|