C21H16Cl2N8O4 — CID 22143089
1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]pyrrole-2,5-dione (PubChem CID 22143089) has the molecular formula C21H16Cl2N8O4 and a molecular weight of 515.32 g/mol. Its IUPAC name is 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22143089 |
| Molecular Formula | C21H16Cl2N8O4 |
| Molecular Weight | 515.32 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]pyrrole-2,5-dione |
| SMILES | Nc1nc(NCCNc2ncc(N3C(=O)C=CC3=O)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16Cl2N8O4/c22-11-1-2-12(13(23)9-11)19-15(30-17(32)5-6-18(30)33)10-27-21(29-19)26-8-7-25-16-4-3-14(31(34)35)20(24)28-16/h1-6,9-10H,7-8H2,(H3,24,25,28)(H,26,27,29) |
| InChIKey | IMQUFEGSDGBHHE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 169.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|