C25H27Cl2N9O5 — CID 23572777
1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4,6-dichlorocyclohexa-1,5-dien-1-yl)pyrimidin-5-yl]-3-morpholin-4-ylpyrrolidine-2,5-dione (PubChem CID 23572777) has the molecular formula C25H27Cl2N9O5 and a molecular weight of 604.46 g/mol. Its IUPAC name is 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4,6-dichlorocyclohexa-1,5-dien-1-yl)pyrimidin-5-yl]-3-morpholin-4-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4,6-dichlorocyclohexa-1,5-dien-1-yl)pyrimidin-5-yl]-3-morpholin-4-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 23572777 |
| Molecular Formula | C25H27Cl2N9O5 |
| Molecular Weight | 604.46 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 1-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(4,6-dichlorocyclohexa-1,5-dien-1-yl)pyrimidin-5-yl]-3-morpholin-4-ylpyrrolidine-2,5-dione |
| SMILES | Nc1nc(NCCNc2ncc(N3C(=O)CC(N4CCOCC4)C3=O)c(C3=CCC(Cl)C=C3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27Cl2N9O5/c26-14-1-2-15(16(27)11-14)22-19(35-21(37)12-18(24(35)38)34-7-9-41-10-8-34)13-31-25(33-22)30-6-5-29-20-4-3-17(36(39)40)23(28)32-20/h2-4,11,13-14,18H,1,5-10,12H2,(H3,28,29,32)(H,30,31,33) |
| InChIKey | XDGSTKUDAZHBTE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 181.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|