C22H23Cl2N9O2 — CID 69307517
N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-N'-cyclopropylethanimidamide (PubChem CID 69307517) has the molecular formula C22H23Cl2N9O2 and a molecular weight of 516.39 g/mol. Its IUPAC name is N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-N'-cyclopropylethanimidamide.
| Compound Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-N'-cyclopropylethanimidamide |
|---|---|
| PubChem CID | 69307517 |
| Molecular Formula | C22H23Cl2N9O2 |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | N-[2-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-4-(2,4-dichlorophenyl)pyrimidin-5-yl]-N'-cyclopropylethanimidamide |
| SMILES | C/C(=N\C1CC1)Nc1cnc(NCCNc2ccc([N+](=O)[O-])c(N)n2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H23Cl2N9O2/c1-12(29-14-3-4-14)30-17-11-28-22(32-20(17)15-5-2-13(23)10-16(15)24)27-9-8-26-19-7-6-18(33(34)35)21(25)31-19/h2,5-7,10-11,14H,3-4,8-9H2,1H3,(H,29,30)(H3,25,26,31)(H,27,28,32) |
| InChIKey | QQWRVKKDLZURLH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|