C20H21Cl2N7O — CID 21354466
N-[5-[2-[(6-amino-5-methyl-2-pyridinyl)amino]ethylamino]-3-(2,4-dichlorophenyl)pyrazin-2-yl]acetamide (PubChem CID 21354466) has the molecular formula C20H21Cl2N7O and a molecular weight of 446.34 g/mol. Its IUPAC name is N-[5-[2-[(6-amino-5-methyl-2-pyridinyl)amino]ethylamino]-3-(2,4-dichlorophenyl)pyrazin-2-yl]acetamide.
| Compound Name | N-[5-[2-[(6-amino-5-methyl-2-pyridinyl)amino]ethylamino]-3-(2,4-dichlorophenyl)pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 21354466 |
| Molecular Formula | C20H21Cl2N7O |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[5-[2-[(6-amino-5-methyl-2-pyridinyl)amino]ethylamino]-3-(2,4-dichlorophenyl)pyrazin-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(NCCNc2ccc(C)c(N)n2)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H21Cl2N7O/c1-11-3-6-16(29-19(11)23)24-7-8-25-17-10-26-20(27-12(2)30)18(28-17)14-5-4-13(21)9-15(14)22/h3-6,9-10H,7-8H2,1-2H3,(H,25,28)(H3,23,24,29)(H,26,27,30) |
| InChIKey | UDOLLIWQMBPTAR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|