C21H19Cl2N7O — CID 59313115
1-[2-amino-6-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]ethanone (PubChem CID 59313115) has the molecular formula C21H19Cl2N7O and a molecular weight of 456.34 g/mol. Its IUPAC name is 1-[2-amino-6-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]ethanone.
| Compound Name | 1-[2-amino-6-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 59313115 |
| Molecular Formula | C21H19Cl2N7O |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-[2-amino-6-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3nccn23)nc1N |
| InChI | InChI=1S/C21H19Cl2N7O/c1-12(31)14-4-5-18(29-20(14)24)25-6-7-27-21-28-17(11-19-26-8-9-30(19)21)15-3-2-13(22)10-16(15)23/h2-5,8-11H,6-7H2,1H3,(H,27,28)(H3,24,25,29) |
| InChIKey | NYVRIGKRHIMXSS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|