C21H19BrCl2N6O3 — CID 22254164
N-[4-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-2-(2,4-dichlorophenyl)phenyl]-2-bromoacetamide (PubChem CID 22254164) has the molecular formula C21H19BrCl2N6O3 and a molecular weight of 554.23 g/mol. Its IUPAC name is N-[4-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-2-(2,4-dichlorophenyl)phenyl]-2-bromoacetamide.
| Compound Name | N-[4-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-2-(2,4-dichlorophenyl)phenyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 22254164 |
| Molecular Formula | C21H19BrCl2N6O3 |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | N-[4-[2-[(6-amino-5-nitro-2-pyridinyl)amino]ethylamino]-2-(2,4-dichlorophenyl)phenyl]-2-bromoacetamide |
| SMILES | Nc1nc(NCCNc2ccc(NC(=O)CBr)c(-c3ccc(Cl)cc3Cl)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19BrCl2N6O3/c22-11-20(31)28-17-4-2-13(10-15(17)14-3-1-12(23)9-16(14)24)26-7-8-27-19-6-5-18(30(32)33)21(25)29-19/h1-6,9-10,26H,7-8,11H2,(H,28,31)(H3,25,27,29) |
| InChIKey | XJOUAXUSEIXJRM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|