C19H15Cl2N7O3 — CID 59313084
6-N-[2-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]oxyethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313084) has the molecular formula C19H15Cl2N7O3 and a molecular weight of 460.28 g/mol. Its IUPAC name is 6-N-[2-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]oxyethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]oxyethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313084 |
| Molecular Formula | C19H15Cl2N7O3 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 6-N-[2-[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]oxyethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCOc2nc(-c3ccc(Cl)cc3Cl)cc3nccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15Cl2N7O3/c20-11-1-2-12(13(21)9-11)14-10-17-24-5-7-27(17)19(25-14)31-8-6-23-16-4-3-15(28(29)30)18(22)26-16/h1-5,7,9-10H,6,8H2,(H3,22,23,26) |
| InChIKey | GASLOMULBYJTHC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|