C20H19ClN8O3 — CID 59313135
6-N-[2-[[7-(5-chloro-2-methoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313135) has the molecular formula C20H19ClN8O3 and a molecular weight of 454.88 g/mol. Its IUPAC name is 6-N-[2-[[7-(5-chloro-2-methoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-(5-chloro-2-methoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313135 |
| Molecular Formula | C20H19ClN8O3 |
| Molecular Weight | 454.88 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 6-N-[2-[[7-(5-chloro-2-methoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | COc1ccc(Cl)cc1-c1cc2nccn2c(NCCNc2ccc([N+](=O)[O-])c(N)n2)n1 |
| InChI | InChI=1S/C20H19ClN8O3/c1-32-16-4-2-12(21)10-13(16)14-11-18-24-8-9-28(18)20(26-14)25-7-6-23-17-5-3-15(29(30)31)19(22)27-17/h2-5,8-11H,6-7H2,1H3,(H,25,26)(H3,22,23,27) |
| InChIKey | TZNJECCAIHBAOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|