C21H21N7O2 — CID 147713752
N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(4-methylphenyl)imidazo[1,2-c]pyrimidin-5-amine (PubChem CID 147713752) has the molecular formula C21H21N7O2 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(4-methylphenyl)imidazo[1,2-c]pyrimidin-5-amine.
| Compound Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(4-methylphenyl)imidazo[1,2-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 147713752 |
| Molecular Formula | C21H21N7O2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(4-methylphenyl)imidazo[1,2-c]pyrimidin-5-amine |
| SMILES | Cc1ccc(-c2cc3nccn3c(NCCCc3ccc([N+](=O)[O-])c(N)n3)n2)cc1 |
| InChI | InChI=1S/C21H21N7O2/c1-14-4-6-15(7-5-14)17-13-19-23-11-12-27(19)21(26-17)24-10-2-3-16-8-9-18(28(29)30)20(22)25-16/h4-9,11-13H,2-3,10H2,1H3,(H2,22,25)(H,24,26) |
| InChIKey | GVFJKZIWHJIQKC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|