C23H25N7O2 — CID 161190485
N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3,5-dimethylphenyl)-2-methylimidazo[1,2-c]pyrimidin-5-amine (PubChem CID 161190485) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3,5-dimethylphenyl)-2-methylimidazo[1,2-c]pyrimidin-5-amine.
| Compound Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3,5-dimethylphenyl)-2-methylimidazo[1,2-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 161190485 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[3-(6-amino-5-nitro-2-pyridinyl)propyl]-7-(3,5-dimethylphenyl)-2-methylimidazo[1,2-c]pyrimidin-5-amine |
| SMILES | Cc1cc(C)cc(-c2cc3nc(C)cn3c(NCCCc3ccc([N+](=O)[O-])c(N)n3)n2)c1 |
| InChI | InChI=1S/C23H25N7O2/c1-14-9-15(2)11-17(10-14)19-12-21-26-16(3)13-29(21)23(28-19)25-8-4-5-18-6-7-20(30(31)32)22(24)27-18/h6-7,9-13H,4-5,8H2,1-3H3,(H2,24,27)(H,25,28) |
| InChIKey | UTQOVBSPSDLKCZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|