C21H16F6N8O2 — CID 59313158
6-N-[2-[[7-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine (PubChem CID 59313158) has the molecular formula C21H16F6N8O2 and a molecular weight of 526.40 g/mol. Its IUPAC name is 6-N-[2-[[7-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[7-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 59313158 |
| Molecular Formula | C21H16F6N8O2 |
| Molecular Weight | 526.40 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 6-N-[2-[[7-[2,4-bis(trifluoromethyl)phenyl]imidazo[1,2-c]pyrimidin-5-yl]amino]ethyl]-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(NCCNc2nc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)cc3nccn23)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16F6N8O2/c22-20(23,24)11-1-2-12(13(9-11)21(25,26)27)14-10-17-30-7-8-34(17)19(32-14)31-6-5-29-16-4-3-15(35(36)37)18(28)33-16/h1-4,7-10H,5-6H2,(H,31,32)(H3,28,29,33) |
| InChIKey | IFMLDVKQLYRGLW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|