C17H16Cl2N8OS — CID 88583483
N-[4-amino-2-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazol-5-yl]hydroxylamine (PubChem CID 88583483) has the molecular formula C17H16Cl2N8OS and a molecular weight of 451.34 g/mol. Its IUPAC name is N-[4-amino-2-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazol-5-yl]hydroxylamine.
| Compound Name | N-[4-amino-2-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazol-5-yl]hydroxylamine |
|---|---|
| PubChem CID | 88583483 |
| Molecular Formula | C17H16Cl2N8OS |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[4-amino-2-[2-[[7-(2,4-dichlorophenyl)imidazo[1,2-c]pyrimidin-5-yl]amino]ethylamino]-1,3-thiazol-5-yl]hydroxylamine |
| SMILES | Nc1nc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3nccn23)sc1NO |
| InChI | InChI=1S/C17H16Cl2N8OS/c18-9-1-2-10(11(19)7-9)12-8-13-21-5-6-27(13)16(24-12)22-3-4-23-17-25-14(20)15(26-28)29-17/h1-2,5-8,26,28H,3-4,20H2,(H,22,24)(H,23,25) |
| InChIKey | TVIZMFKSKQFBAT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|